C18H20N4O4 — CID 120690264
5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120690264) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120690264 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(=O)NCc2ccnc(OC3CCCCC3)c2)cn1 |
| InChI | InChI=1S/C18H20N4O4/c23-17(14-10-21-15(11-20-14)18(24)25)22-9-12-6-7-19-16(8-12)26-13-4-2-1-3-5-13/h6-8,10-11,13H,1-5,9H2,(H,22,23)(H,24,25) |
| InChIKey | NUORSPKTMIVCCN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |