C20H24N2O5 — CID 120822564
5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]-2-ethylfuran-3-carboxylic acid (PubChem CID 120822564) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]-2-ethylfuran-3-carboxylic acid.
| Compound Name | 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 120822564 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[(2-cyclohexyloxy-4-pyridinyl)methylcarbamoyl]-2-ethylfuran-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)NCc2ccnc(OC3CCCCC3)c2)cc1C(=O)O |
| InChI | InChI=1S/C20H24N2O5/c1-2-16-15(20(24)25)11-17(27-16)19(23)22-12-13-8-9-21-18(10-13)26-14-6-4-3-5-7-14/h8-11,14H,2-7,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | LNTUECOZKARJCB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |