C19H20N4O4 — CID 120690266
5-[2-(benzamidomethyl)piperidine-1-carbonyl]pyrazine-2-carboxylic acid (PubChem CID 120690266) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 5-[2-(benzamidomethyl)piperidine-1-carbonyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[2-(benzamidomethyl)piperidine-1-carbonyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120690266 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-[2-(benzamidomethyl)piperidine-1-carbonyl]pyrazine-2-carboxylic acid |
| SMILES | O=C(NCC1CCCCN1C(=O)c1cnc(C(=O)O)cn1)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O4/c24-17(13-6-2-1-3-7-13)22-10-14-8-4-5-9-23(14)18(25)15-11-21-16(12-20-15)19(26)27/h1-3,6-7,11-12,14H,4-5,8-10H2,(H,22,24)(H,26,27) |
| InChIKey | BXXIQPSPRCAEOI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |