C18H19ClN4O3 — CID 133342411
N-[[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-2-yl]methyl]benzamide (PubChem CID 133342411) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is N-[[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-2-yl]methyl]benzamide.
| Compound Name | N-[[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 133342411 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[[1-(3-chloro-5-nitro-2-pyridinyl)piperidin-2-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCCCN1c1ncc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN4O3/c19-16-10-15(23(25)26)12-20-17(16)22-9-5-4-8-14(22)11-21-18(24)13-6-2-1-3-7-13/h1-3,6-7,10,12,14H,4-5,8-9,11H2,(H,21,24) |
| InChIKey | DNUTVXKJJJAHDY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|