C13H12ClN3O3 — CID 133304580
3-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]-5-nitropyridine (PubChem CID 133304580) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is 3-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]-5-nitropyridine.
| Compound Name | 3-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]-5-nitropyridine |
|---|---|
| PubChem CID | 133304580 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]-5-nitropyridine |
| SMILES | O=[N+]([O-])c1cnc(N2CCCC2c2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClN3O3/c14-10-7-9(17(18)19)8-15-13(10)16-5-1-3-11(16)12-4-2-6-20-12/h2,4,6-8,11H,1,3,5H2 |
| InChIKey | HWEDRJKGNQSHFG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|