C15H13ClN2O — CID 133304579
4-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]benzonitrile (PubChem CID 133304579) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 4-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133304579 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-chloro-2-[2-(furan-2-yl)pyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1N1CCCC1c1ccco1 |
| InChI | InChI=1S/C15H13ClN2O/c16-12-6-5-11(10-17)14(9-12)18-7-1-3-13(18)15-4-2-8-19-15/h2,4-6,8-9,13H,1,3,7H2 |
| InChIKey | ZGNYKCRSXSBJFP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |