C18H18ClN3O2 — CID 124726563
N-[[(3S)-1-(5-chloro-2-cyanophenyl)piperidin-3-yl]methyl]furan-2-carboxamide (PubChem CID 124726563) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-[[(3S)-1-(5-chloro-2-cyanophenyl)piperidin-3-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[(3S)-1-(5-chloro-2-cyanophenyl)piperidin-3-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 124726563 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[[(3S)-1-(5-chloro-2-cyanophenyl)piperidin-3-yl]methyl]furan-2-carboxamide |
| SMILES | N#Cc1ccc(Cl)cc1N1CCC[C@@H](CNC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C18H18ClN3O2/c19-15-6-5-14(10-20)16(9-15)22-7-1-3-13(12-22)11-21-18(23)17-4-2-8-24-17/h2,4-6,8-9,13H,1,3,7,11-12H2,(H,21,23)/t13-/m0/s1 |
| InChIKey | CCOOMFNDMDOVJC-ZDUSSCGKSA-N |
| XLogP | 3.45 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |