C12H16ClN5O3 — CID 97101938
[(2S)-1-(5-chloro-3-nitro-2-pyridinyl)piperidin-2-yl]methylurea (PubChem CID 97101938) has the molecular formula C12H16ClN5O3 and a molecular weight of 313.75 g/mol. Its IUPAC name is [(2S)-1-(5-chloro-3-nitro-2-pyridinyl)piperidin-2-yl]methylurea.
| Compound Name | [(2S)-1-(5-chloro-3-nitro-2-pyridinyl)piperidin-2-yl]methylurea |
|---|---|
| PubChem CID | 97101938 |
| Molecular Formula | C12H16ClN5O3 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [(2S)-1-(5-chloro-3-nitro-2-pyridinyl)piperidin-2-yl]methylurea |
| SMILES | NC(=O)NC[C@@H]1CCCCN1c1ncc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16ClN5O3/c13-8-5-10(18(20)21)11(15-6-8)17-4-2-1-3-9(17)7-16-12(14)19/h5-6,9H,1-4,7H2,(H3,14,16,19)/t9-/m0/s1 |
| InChIKey | JQKSIBKZFHJFLF-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|