About N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide
N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide (PubChem CID 133403725) has the molecular formula C21H24N4OS
and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide.
Molecular Properties
| Compound Name | N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide |
| PubChem CID | 133403725 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide |
| SMILES | CCc1nc(N2CCCCC2CNC(=O)c2ccccc2)c2ccsc2n1 |
| InChI | InChI=1S/C21H24N4OS/c1-2-18-23-19(17-11-13-27-21(17)24-18)25-12-7-6-10-16(25)14-22-20(26)15-8-4-3-5-9-15/h3-5,8-9,11,13,16H,2,6-7,10,12,14H2,1H3,(H,22,26) |
| InChIKey | UGHSEZNRCYZDPX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide?
The IUPAC name of N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide (CID 133403725) is N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide.
What is the SMILES notation for N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide?
The canonical SMILES for N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide is CCc1nc(N2CCCCC2CNC(=O)c2ccccc2)c2ccsc2n1.
What is the InChIKey of N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide?
The InChIKey is UGHSEZNRCYZDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4OS/c1-2-18-23-19(17-11-13-27-21(17)24-18)25-12-7-6-10-16(25)14-22-20(26)15-8-4-3-5-9-15/h3-5,8-9,11,13,16H,2,6-7,10,12,14H2,1H3,(H,22,26).
What are the key properties of N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide?
N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide has a molecular weight of 380.52 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-2-yl]methyl]benzamide is sourced from PubChem (CID 133403725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).