C15H21N3OS — CID 133423681
1-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethanol (PubChem CID 133423681) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethanol.
| Compound Name | 1-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 133423681 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethanol |
| SMILES | CCc1nc(N2CCCC(C(C)O)C2)c2ccsc2n1 |
| InChI | InChI=1S/C15H21N3OS/c1-3-13-16-14(12-6-8-20-15(12)17-13)18-7-4-5-11(9-18)10(2)19/h6,8,10-11,19H,3-5,7,9H2,1-2H3 |
| InChIKey | MMOIQQAETJGLJH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |