About 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine
5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine (PubChem CID 133403957) has the molecular formula C16H20N6S
and a molecular weight of 328.45 g/mol. Its IUPAC name is 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine |
| PubChem CID | 133403957 |
| Molecular Formula | C16H20N6S |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine |
| SMILES | CCc1nc(N2CCC(c3cc(N)n[nH]3)CC2)c2ccsc2n1 |
| InChI | InChI=1S/C16H20N6S/c1-2-14-18-15(11-5-8-23-16(11)19-14)22-6-3-10(4-7-22)12-9-13(17)21-20-12/h5,8-10H,2-4,6-7H2,1H3,(H3,17,20,21) |
| InChIKey | SEKQGXMAJNEOTR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The IUPAC name of 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine (CID 133403957) is 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine.
What is the SMILES notation for 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The canonical SMILES for 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine is CCc1nc(N2CCC(c3cc(N)n[nH]3)CC2)c2ccsc2n1.
What is the InChIKey of 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
The InChIKey is SEKQGXMAJNEOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6S/c1-2-14-18-15(11-5-8-23-16(11)19-14)22-6-3-10(4-7-22)12-9-13(17)21-20-12/h5,8-10H,2-4,6-7H2,1H3,(H3,17,20,21).
What are the key properties of 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine?
5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine has a molecular weight of 328.45 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2-ethylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-yl]-1H-pyrazol-3-amine is sourced from PubChem (CID 133403957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).