C16H21N3S2 — CID 133404111
4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine (PubChem CID 133404111) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine.
| Compound Name | 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
|---|---|
| PubChem CID | 133404111 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-(2-ethylthieno[2,3-d]pyrimidin-4-yl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine |
| SMILES | CCc1nc(N2CCSC3CCCCC32)c2ccsc2n1 |
| InChI | InChI=1S/C16H21N3S2/c1-2-14-17-15(11-7-9-21-16(11)18-14)19-8-10-20-13-6-4-3-5-12(13)19/h7,9,12-13H,2-6,8,10H2,1H3 |
| InChIKey | GUTZBPUJHNMQCW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |