C15H14N2O5 — CID 120690748
5-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]-1-benzofuran-2-carboxylic acid (PubChem CID 120690748) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 5-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 120690748 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-[[1-(methylcarbamoyl)cyclopropanecarbonyl]amino]-1-benzofuran-2-carboxylic acid |
| SMILES | CNC(=O)C1(C(=O)Nc2ccc3oc(C(=O)O)cc3c2)CC1 |
| InChI | InChI=1S/C15H14N2O5/c1-16-13(20)15(4-5-15)14(21)17-9-2-3-10-8(6-9)7-11(22-10)12(18)19/h2-3,6-7H,4-5H2,1H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | ZRYPLONTXZCTGT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|