C19H12N2O7 — CID 71013533
5-[(2-carboxy-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-carboxylic acid (PubChem CID 71013533) has the molecular formula C19H12N2O7 and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-[(2-carboxy-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[(2-carboxy-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 71013533 |
| Molecular Formula | C19H12N2O7 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-[(2-carboxy-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(Nc1ccc2oc(C(=O)O)cc2c1)Nc1ccc2oc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C19H12N2O7/c22-17(23)15-7-9-5-11(1-3-13(9)27-15)20-19(26)21-12-2-4-14-10(6-12)8-16(28-14)18(24)25/h1-8H,(H,22,23)(H,24,25)(H2,20,21,26) |
| InChIKey | AILGIAHEXSLTKY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 142.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |