C19H12Cl2N2O5 — CID 89187918
[5-[(2-carbonochloridoyl-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-yl]methyl hypochlorite (PubChem CID 89187918) has the molecular formula C19H12Cl2N2O5 and a molecular weight of 419.22 g/mol. Its IUPAC name is [5-[(2-carbonochloridoyl-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-yl]methyl hypochlorite.
| Compound Name | [5-[(2-carbonochloridoyl-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-yl]methyl hypochlorite |
|---|---|
| PubChem CID | 89187918 |
| Molecular Formula | C19H12Cl2N2O5 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | [5-[(2-carbonochloridoyl-1-benzofuran-5-yl)carbamoylamino]-1-benzofuran-2-yl]methyl hypochlorite |
| SMILES | O=C(Nc1ccc2oc(COCl)cc2c1)Nc1ccc2oc(C(=O)Cl)cc2c1 |
| InChI | InChI=1S/C19H12Cl2N2O5/c20-18(24)17-8-11-6-13(2-4-16(11)28-17)23-19(25)22-12-1-3-15-10(5-12)7-14(27-15)9-26-21/h1-8H,9H2,(H2,22,23,25) |
| InChIKey | AKGKZGRVHMKIPL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|