C16H19NO6S — CID 120690836
5-[(2-pentylsulfonylacetyl)amino]-1-benzofuran-2-carboxylic acid (PubChem CID 120690836) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-[(2-pentylsulfonylacetyl)amino]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[(2-pentylsulfonylacetyl)amino]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 120690836 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[(2-pentylsulfonylacetyl)amino]-1-benzofuran-2-carboxylic acid |
| SMILES | CCCCCS(=O)(=O)CC(=O)Nc1ccc2oc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C16H19NO6S/c1-2-3-4-7-24(21,22)10-15(18)17-12-5-6-13-11(8-12)9-14(23-13)16(19)20/h5-6,8-9H,2-4,7,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | NTTOEDZSDRSKRK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|