C20H21NO3 — CID 120691335
1-[3-(2-methylphenyl)butanoyl]-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691335) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[3-(2-methylphenyl)butanoyl]-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-[3-(2-methylphenyl)butanoyl]-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691335 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[3-(2-methylphenyl)butanoyl]-2,3-dihydroindole-3-carboxylic acid |
| SMILES | Cc1ccccc1C(C)CC(=O)N1CC(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C20H21NO3/c1-13-7-3-4-8-15(13)14(2)11-19(22)21-12-17(20(23)24)16-9-5-6-10-18(16)21/h3-10,14,17H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | XGKZDWPVHIXDFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |