C15H17NO5S — CID 120691430
1-(1,1-dioxothiane-2-carbonyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691430) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiane-2-carbonyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiane-2-carbonyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691430 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-(1,1-dioxothiane-2-carbonyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)C2CCCCS2(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C15H17NO5S/c17-14(13-7-3-4-8-22(13,20)21)16-9-11(15(18)19)10-5-1-2-6-12(10)16/h1-2,5-6,11,13H,3-4,7-9H2,(H,18,19) |
| InChIKey | CHUIKARMPBQQNO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |