C18H22FNO3 — CID 120691973
1-[2-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]cyclobutane-1-carboxylic acid (PubChem CID 120691973) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[2-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120691973 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[2-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-2-oxoethyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCC1)N1CCC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22FNO3/c19-15-4-2-13(3-5-15)10-14-6-9-20(12-14)16(21)11-18(17(22)23)7-1-8-18/h2-5,14H,1,6-12H2,(H,22,23) |
| InChIKey | NTPHNIOUMZDDNB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |