C18H17FN2O3 — CID 120692128
4-[2-(3-fluorophenyl)-4-methylpyrrolidine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 120692128) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)-4-methylpyrrolidine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[2-(3-fluorophenyl)-4-methylpyrrolidine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 120692128 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[2-(3-fluorophenyl)-4-methylpyrrolidine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | CC1CC(c2cccc(F)c2)N(C(=O)c2ccnc(C(=O)O)c2)C1 |
| InChI | InChI=1S/C18H17FN2O3/c1-11-7-16(12-3-2-4-14(19)8-12)21(10-11)17(22)13-5-6-20-15(9-13)18(23)24/h2-6,8-9,11,16H,7,10H2,1H3,(H,23,24) |
| InChIKey | PXLKGGKXRRDKFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |