C13H17FN2O — CID 136528712
2-(3-fluorophenyl)-N,4-dimethylpyrrolidine-1-carboxamide (PubChem CID 136528712) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N,4-dimethylpyrrolidine-1-carboxamide.
| Compound Name | 2-(3-fluorophenyl)-N,4-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 136528712 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-(3-fluorophenyl)-N,4-dimethylpyrrolidine-1-carboxamide |
| SMILES | CNC(=O)N1CC(C)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O/c1-9-6-12(16(8-9)13(17)15-2)10-4-3-5-11(14)7-10/h3-5,7,9,12H,6,8H2,1-2H3,(H,15,17) |
| InChIKey | MPHUUXHBJIPKKJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |