C17H22N2O4 — CID 120692535
(E)-2-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]hex-4-enoic acid (PubChem CID 120692535) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (E)-2-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692535 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (E)-2-[(2-oxo-1,5,6,7,8,9-hexahydrocyclohepta[b]pyridine-3-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc2c([nH]c1=O)CCCCC2)C(=O)O |
| InChI | InChI=1S/C17H22N2O4/c1-2-3-8-14(17(22)23)19-16(21)12-10-11-7-5-4-6-9-13(11)18-15(12)20/h2-3,10,14H,4-9H2,1H3,(H,18,20)(H,19,21)(H,22,23)/b3-2+ |
| InChIKey | GYVVKMBRCIUCDL-NSCUHMNNSA-N |
| XLogP | 1.79 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|