C19H20N4O3S — CID 120692916
(E)-2-[(1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hex-4-enoic acid (PubChem CID 120692916) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is (E)-2-[(1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692916 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (E)-2-[(1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(-c2cccs2)nc2c1c(C)nn2C)C(=O)O |
| InChI | InChI=1S/C19H20N4O3S/c1-4-5-7-13(19(25)26)21-18(24)12-10-14(15-8-6-9-27-15)20-17-16(12)11(2)22-23(17)3/h4-6,8-10,13H,7H2,1-3H3,(H,21,24)(H,25,26)/b5-4+ |
| InChIKey | HGZFIAYTSZMHIB-SNAWJCMRSA-N |
| XLogP | 3.15 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|