C15H15ClN2O3S2 — CID 120693085
(E)-2-[[2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]amino]hex-4-enoic acid (PubChem CID 120693085) has the molecular formula C15H15ClN2O3S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is (E)-2-[[2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693085 |
| Molecular Formula | C15H15ClN2O3S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (E)-2-[[2-[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)Cc1csc(-c2ccc(Cl)s2)n1)C(=O)O |
| InChI | InChI=1S/C15H15ClN2O3S2/c1-2-3-4-10(15(20)21)18-13(19)7-9-8-22-14(17-9)11-5-6-12(16)23-11/h2-3,5-6,8,10H,4,7H2,1H3,(H,18,19)(H,20,21)/b3-2+ |
| InChIKey | LIFVZQJHSXQECX-NSCUHMNNSA-N |
| XLogP | 3.60 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|