C15H17N3O3 — CID 120693374
(E)-2-[(2-imidazo[1,2-a]pyridin-2-ylacetyl)amino]hex-4-enoic acid (PubChem CID 120693374) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (E)-2-[(2-imidazo[1,2-a]pyridin-2-ylacetyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(2-imidazo[1,2-a]pyridin-2-ylacetyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693374 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (E)-2-[(2-imidazo[1,2-a]pyridin-2-ylacetyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)Cc1cn2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C15H17N3O3/c1-2-3-6-12(15(20)21)17-14(19)9-11-10-18-8-5-4-7-13(18)16-11/h2-5,7-8,10,12H,6,9H2,1H3,(H,17,19)(H,20,21)/b3-2+ |
| InChIKey | DAYPRYJRSJIARK-NSCUHMNNSA-N |
| XLogP | 1.41 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|