C18H20F3N3O3 — CID 120693849
(E)-2-[[1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693849) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is (E)-2-[[1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693849 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (E)-2-[[1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc2c(c1)nc(C(F)(F)F)n2C(C)C)C(=O)O |
| InChI | InChI=1S/C18H20F3N3O3/c1-4-5-6-12(16(26)27)22-15(25)11-7-8-14-13(9-11)23-17(18(19,20)21)24(14)10(2)3/h4-5,7-10,12H,6H2,1-3H3,(H,22,25)(H,26,27)/b5-4+ |
| InChIKey | AEDGVUGYYJWGPD-SNAWJCMRSA-N |
| XLogP | 3.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|