C17H20N4O3S — CID 120694217
(E)-2-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hex-4-enoic acid (PubChem CID 120694217) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is (E)-2-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694217 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (E)-2-[[2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CSc1nncn1-c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C17H20N4O3S/c1-3-4-5-14(16(23)24)19-15(22)10-25-17-20-18-11-21(17)13-8-6-12(2)7-9-13/h3-4,6-9,11,14H,5,10H2,1-2H3,(H,19,22)(H,23,24)/b4-3+ |
| InChIKey | XFDYDFLHJZZVQZ-ONEGZZNKSA-N |
| XLogP | 2.20 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|