C15H17FN2O4 — CID 120694236
(E)-2-[(5-acetamido-2-fluorobenzoyl)amino]hex-4-enoic acid (PubChem CID 120694236) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is (E)-2-[(5-acetamido-2-fluorobenzoyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(5-acetamido-2-fluorobenzoyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694236 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (E)-2-[(5-acetamido-2-fluorobenzoyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(NC(C)=O)ccc1F)C(=O)O |
| InChI | InChI=1S/C15H17FN2O4/c1-3-4-5-13(15(21)22)18-14(20)11-8-10(17-9(2)19)6-7-12(11)16/h3-4,6-8,13H,5H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)/b4-3+ |
| InChIKey | OGXAITMCFOJBMK-ONEGZZNKSA-N |
| XLogP | 1.93 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|