C17H20N2O4 — CID 120694245
(E)-2-[[2-(2-oxo-3,4-dihydroquinolin-1-yl)acetyl]amino]hex-4-enoic acid (PubChem CID 120694245) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (E)-2-[[2-(2-oxo-3,4-dihydroquinolin-1-yl)acetyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-(2-oxo-3,4-dihydroquinolin-1-yl)acetyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694245 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (E)-2-[[2-(2-oxo-3,4-dihydroquinolin-1-yl)acetyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)CN1C(=O)CCc2ccccc21)C(=O)O |
| InChI | InChI=1S/C17H20N2O4/c1-2-3-7-13(17(22)23)18-15(20)11-19-14-8-5-4-6-12(14)9-10-16(19)21/h2-6,8,13H,7,9-11H2,1H3,(H,18,20)(H,22,23)/b3-2+ |
| InChIKey | BEBHQEYREVQNGF-NSCUHMNNSA-N |
| XLogP | 1.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|