C19H21N3O5 — CID 120695954
5-[[4-(oxan-4-yloxymethyl)phenyl]methylcarbamoyl]pyrazine-2-carboxylic acid (PubChem CID 120695954) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-[[4-(oxan-4-yloxymethyl)phenyl]methylcarbamoyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[4-(oxan-4-yloxymethyl)phenyl]methylcarbamoyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 120695954 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 5-[[4-(oxan-4-yloxymethyl)phenyl]methylcarbamoyl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(C(=O)NCc2ccc(COC3CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C19H21N3O5/c23-18(16-10-21-17(11-20-16)19(24)25)22-9-13-1-3-14(4-2-13)12-27-15-5-7-26-8-6-15/h1-4,10-11,15H,5-9,12H2,(H,22,23)(H,24,25) |
| InChIKey | LZJWRDYYCBHRGU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |