C19H22ClN3O4 — CID 120696695
2-[4-[[4-(3-chlorophenyl)oxane-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoic acid (PubChem CID 120696695) has the molecular formula C19H22ClN3O4 and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-[4-[[4-(3-chlorophenyl)oxane-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[4-(3-chlorophenyl)oxane-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120696695 |
| Molecular Formula | C19H22ClN3O4 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[4-[[4-(3-chlorophenyl)oxane-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)C2(c3cccc(Cl)c3)CCOCC2)cn1 |
| InChI | InChI=1S/C19H22ClN3O4/c1-18(2,17(25)26)23-12-15(11-21-23)22-16(24)19(6-8-27-9-7-19)13-4-3-5-14(20)10-13/h3-5,10-12H,6-9H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | XQPOGADCNWWMRA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |