C22H26Cl2N2O4S — CID 55996926
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(3-chlorophenyl)oxane-4-carboxamide (PubChem CID 55996926) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(3-chlorophenyl)oxane-4-carboxamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(3-chlorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 55996926 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-4-(3-chlorophenyl)oxane-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2(c3cccc(Cl)c3)CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H26Cl2N2O4S/c1-3-26(4-2)31(28,29)20-15-18(8-9-19(20)24)25-21(27)22(10-12-30-13-11-22)16-6-5-7-17(23)14-16/h5-9,14-15H,3-4,10-13H2,1-2H3,(H,25,27) |
| InChIKey | DIPZRTVMBCMWDN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |