C15H17ClN4O4 — CID 120698374
2-[4-[[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698374) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[4-[[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698374 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-[[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C15H17ClN4O4/c1-15(2,24-12-5-3-10(16)4-6-12)14(23)17-7-11-8-20(19-18-11)9-13(21)22/h3-6,8H,7,9H2,1-2H3,(H,17,23)(H,21,22) |
| InChIKey | IFWUTCQUJWFGID-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |