C15H15FN4O3 — CID 120698426
2-[4-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698426) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[4-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698426 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[4-[[[1-(2-fluorophenyl)cyclopropanecarbonyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)C2(c3ccccc3F)CC2)nn1 |
| InChI | InChI=1S/C15H15FN4O3/c16-12-4-2-1-3-11(12)15(5-6-15)14(23)17-7-10-8-20(19-18-10)9-13(21)22/h1-4,8H,5-7,9H2,(H,17,23)(H,21,22) |
| InChIKey | GKFGQLCPNCQOTF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |