C18H32N2O5 — CID 120700108
1-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid (PubChem CID 120700108) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 1-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120700108 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[4-(2,2-dimethylpropanoylamino)butanoylamino]-3-ethoxy-2,2-dimethylcyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)CCCNC(=O)C(C)(C)C)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C18H32N2O5/c1-7-25-12-11-18(15(23)24,17(12,5)6)20-13(21)9-8-10-19-14(22)16(2,3)4/h12H,7-11H2,1-6H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | AYHDBIYZQHVBLW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|