About 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid
3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid (PubChem CID 120700397) has the molecular formula C19H25N5O4
and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid |
| PubChem CID | 120700397 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid |
| SMILES | CCOC1CC(NC(=O)C(C)n2nnc(-c3ccccc3)n2)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C19H25N5O4/c1-5-28-14-11-19(17(26)27,18(14,3)4)20-16(25)12(2)24-22-15(21-23-24)13-9-7-6-8-10-13/h6-10,12,14H,5,11H2,1-4H3,(H,20,25)(H,26,27) |
| InChIKey | RRCIYCLKXAKXJW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid?
The IUPAC name of 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid (CID 120700397) is 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid is CCOC1CC(NC(=O)C(C)n2nnc(-c3ccccc3)n2)(C(=O)O)C1(C)C.
What is the InChIKey of 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid?
The InChIKey is RRCIYCLKXAKXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O4/c1-5-28-14-11-19(17(26)27,18(14,3)4)20-16(25)12(2)24-22-15(21-23-24)13-9-7-6-8-10-13/h6-10,12,14H,5,11H2,1-4H3,(H,20,25)(H,26,27).
What are the key properties of 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid?
3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid has a molecular weight of 387.44 g/mol, XLogP of 1.68, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,2-dimethyl-1-[2-(5-phenyltetrazol-2-yl)propanoylamino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 120700397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).