About 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid
3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120701748) has the molecular formula C19H24FNO4
and a molecular weight of 349.40 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 120701748 |
| Molecular Formula | C19H24FNO4 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC(C(=O)NC[C@@H]2CCO[C@H]2c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H24FNO4/c20-16-6-4-12(5-7-16)17-15(8-9-25-17)11-21-18(22)13-2-1-3-14(10-13)19(23)24/h4-7,13-15,17H,1-3,8-11H2,(H,21,22)(H,23,24)/t13?,14?,15-,17-/m0/s1 |
| InChIKey | ZNVONTFNXFGOMT-NDTCATRNSA-N |
| XLogP | 2.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid (CID 120701748) is 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCCC(C(=O)NC[C@@H]2CCO[C@H]2c2ccc(F)cc2)C1.
What is the InChIKey of 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is ZNVONTFNXFGOMT-NDTCATRNSA-N. The full InChI is InChI=1S/C19H24FNO4/c20-16-6-4-12(5-7-16)17-15(8-9-25-17)11-21-18(22)13-2-1-3-14(10-13)19(23)24/h4-7,13-15,17H,1-3,8-11H2,(H,21,22)(H,23,24)/t13?,14?,15-,17-/m0/s1.
What are the key properties of 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid?
3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 349.40 g/mol, XLogP of 2.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 120701748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).