C19H17FN2O6 — CID 120701750
3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]-5-nitrobenzoic acid (PubChem CID 120701750) has the molecular formula C19H17FN2O6 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]-5-nitrobenzoic acid.
| Compound Name | 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 120701750 |
| Molecular Formula | C19H17FN2O6 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[(2R,3S)-2-(4-fluorophenyl)oxolan-3-yl]methylcarbamoyl]-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(C(=O)NC[C@@H]2CCO[C@H]2c2ccc(F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17FN2O6/c20-15-3-1-11(2-4-15)17-12(5-6-28-17)10-21-18(23)13-7-14(19(24)25)9-16(8-13)22(26)27/h1-4,7-9,12,17H,5-6,10H2,(H,21,23)(H,24,25)/t12-,17-/m0/s1 |
| InChIKey | VDQDUWKMFUEEFF-SJCJKPOMSA-N |
| XLogP | 2.94 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|