C14H16N2O5S — CID 120701904
4-methoxy-2-[(3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]butanoic acid (PubChem CID 120701904) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is 4-methoxy-2-[(3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]butanoic acid.
| Compound Name | 4-methoxy-2-[(3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120701904 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-methoxy-2-[(3-oxo-4H-1,4-benzothiazine-6-carbonyl)amino]butanoic acid |
| SMILES | COCCC(NC(=O)c1ccc2c(c1)NC(=O)CS2)C(=O)O |
| InChI | InChI=1S/C14H16N2O5S/c1-21-5-4-9(14(19)20)16-13(18)8-2-3-11-10(6-8)15-12(17)7-22-11/h2-3,6,9H,4-5,7H2,1H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | JWIZJQBDWGZFRI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |