C15H19ClN2O5 — CID 120701921
2-[[5-chloro-6-(cyclopropylmethoxy)pyridine-3-carbonyl]amino]-4-methoxybutanoic acid (PubChem CID 120701921) has the molecular formula C15H19ClN2O5 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[[5-chloro-6-(cyclopropylmethoxy)pyridine-3-carbonyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[5-chloro-6-(cyclopropylmethoxy)pyridine-3-carbonyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120701921 |
| Molecular Formula | C15H19ClN2O5 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[[5-chloro-6-(cyclopropylmethoxy)pyridine-3-carbonyl]amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1cnc(OCC2CC2)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H19ClN2O5/c1-22-5-4-12(15(20)21)18-13(19)10-6-11(16)14(17-7-10)23-8-9-2-3-9/h6-7,9,12H,2-5,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | OZYXDZFNVYVXPZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |