C13H22ClN3O — CID 120703369
N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120703369) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120703369 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-[[4-[(dimethylamino)methyl]phenyl]methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NCc1ccc(CN(C)C)cc1.Cl |
| InChI | InChI=1S/C13H21N3O.ClH/c1-14-9-13(17)15-8-11-4-6-12(7-5-11)10-16(2)3;/h4-7,14H,8-10H2,1-3H3,(H,15,17);1H |
| InChIKey | LCIILGGXRMZDAC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |