C13H20ClN3O2 — CID 120703395
1-[4-(3-hydroxyphenyl)piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride (PubChem CID 120703395) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-[4-(3-hydroxyphenyl)piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-hydroxyphenyl)piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120703395 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-[4-(3-hydroxyphenyl)piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCN(c2cccc(O)c2)CC1.Cl |
| InChI | InChI=1S/C13H19N3O2.ClH/c1-14-10-13(18)16-7-5-15(6-8-16)11-3-2-4-12(17)9-11;/h2-4,9,14,17H,5-8,10H2,1H3;1H |
| InChIKey | DWAPXKFHDHEKCW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |