C12H18N2O2 — CID 120704917
N-(3-hydroxy-2-phenylpropyl)-2-(methylamino)acetamide (PubChem CID 120704917) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-(3-hydroxy-2-phenylpropyl)-2-(methylamino)acetamide.
| Compound Name | N-(3-hydroxy-2-phenylpropyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 120704917 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-(3-hydroxy-2-phenylpropyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O2/c1-13-8-12(16)14-7-11(9-15)10-5-3-2-4-6-10/h2-6,11,13,15H,7-9H2,1H3,(H,14,16) |
| InChIKey | FJSVAYJXZRJGRT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |