C22H29N3O5S — CID 96529266
3-(diethylsulfamoyl)-N-[2-[[(2R)-3-hydroxy-2-phenylpropyl]amino]-2-oxoethyl]benzamide (PubChem CID 96529266) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[2-[[(2R)-3-hydroxy-2-phenylpropyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[2-[[(2R)-3-hydroxy-2-phenylpropyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 96529266 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[2-[[(2R)-3-hydroxy-2-phenylpropyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NCC(=O)NC[C@H](CO)c2ccccc2)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-3-25(4-2)31(29,30)20-12-8-11-18(13-20)22(28)24-15-21(27)23-14-19(16-26)17-9-6-5-7-10-17/h5-13,19,26H,3-4,14-16H2,1-2H3,(H,23,27)(H,24,28)/t19-/m1/s1 |
| InChIKey | XHNDVXZZHZHBER-LJQANCHMSA-N |
| XLogP | 1.34 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |