About 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride (PubChem CID 120706633) has the molecular formula C12H16BrClN2O3S
and a molecular weight of 383.70 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride |
| PubChem CID | 120706633 |
| Molecular Formula | C12H16BrClN2O3S |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cc(Br)cc2c1OCC2)N1CCNCC1 |
| InChI | InChI=1S/C12H15BrN2O3S.ClH/c13-10-7-9-1-6-18-12(9)11(8-10)19(16,17)15-4-2-14-3-5-15;/h7-8,14H,1-6H2;1H |
| InChIKey | HUZSBHYKEGXDJA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride?
The IUPAC name of 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride (CID 120706633) is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride.
What is the SMILES notation for 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride?
The canonical SMILES for 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride is Cl.O=S(=O)(c1cc(Br)cc2c1OCC2)N1CCNCC1.
What is the InChIKey of 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride?
The InChIKey is HUZSBHYKEGXDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN2O3S.ClH/c13-10-7-9-1-6-18-12(9)11(8-10)19(16,17)15-4-2-14-3-5-15;/h7-8,14H,1-6H2;1H.
What are the key properties of 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride?
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride has a molecular weight of 383.70 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)sulfonyl]piperazine;hydrochloride is sourced from PubChem (CID 120706633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).