C11H16BrClN2O3S — CID 120708703
5-bromo-N-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride (PubChem CID 120708703) has the molecular formula C11H16BrClN2O3S and a molecular weight of 371.68 g/mol. Its IUPAC name is 5-bromo-N-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-N-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708703 |
| Molecular Formula | C11H16BrClN2O3S |
| Molecular Weight | 371.68 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 5-bromo-N-[2-(methylamino)ethyl]-2,3-dihydro-1-benzofuran-7-sulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1cc(Br)cc2c1OCC2.Cl |
| InChI | InChI=1S/C11H15BrN2O3S.ClH/c1-13-3-4-14-18(15,16)10-7-9(12)6-8-2-5-17-11(8)10;/h6-7,13-14H,2-5H2,1H3;1H |
| InChIKey | PLCLUTFEJOHFIE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|