C15H24Cl2N2O3S — CID 120709083
1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 120709083) has the molecular formula C15H24Cl2N2O3S and a molecular weight of 383.34 g/mol. Its IUPAC name is 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120709083 |
| Molecular Formula | C15H24Cl2N2O3S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-[1-(5-chloro-4-methoxy-2-methylphenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCC(C(C)N)CC2)cc1Cl.Cl |
| InChI | InChI=1S/C15H23ClN2O3S.ClH/c1-10-8-14(21-3)13(16)9-15(10)22(19,20)18-6-4-12(5-7-18)11(2)17;/h8-9,11-12H,4-7,17H2,1-3H3;1H |
| InChIKey | FFIJWPOGGSISEQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |