C18H30N2O3S — CID 120709113
1-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)sulfonylpiperidin-4-yl]ethanamine (PubChem CID 120709113) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)sulfonylpiperidin-4-yl]ethanamine.
| Compound Name | 1-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)sulfonylpiperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 120709113 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 1-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)sulfonylpiperidin-4-yl]ethanamine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCC(C(C)N)CC2)cc1C(C)C |
| InChI | InChI=1S/C18H30N2O3S/c1-12(2)16-11-18(13(3)10-17(16)23-5)24(21,22)20-8-6-15(7-9-20)14(4)19/h10-12,14-15H,6-9,19H2,1-5H3 |
| InChIKey | HZRJWCHINRQMIU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |