C16H25ClN2O4S — CID 120712093
ethyl 4-methyl-3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride (PubChem CID 120712093) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is ethyl 4-methyl-3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride.
| Compound Name | ethyl 4-methyl-3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120712093 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethyl 4-methyl-3-[2-(methylaminomethyl)pyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(C)c(S(=O)(=O)N2CCCC2CNC)c1.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-4-22-16(19)13-8-7-12(2)15(10-13)23(20,21)18-9-5-6-14(18)11-17-3;/h7-8,10,14,17H,4-6,9,11H2,1-3H3;1H |
| InChIKey | IZHPDBYOQCNQIK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |