C12H25ClN4O2S — CID 120712297
N-(3-amino-4-methylpentyl)-2-ethyl-N-methylpyrazole-3-sulfonamide;hydrochloride (PubChem CID 120712297) has the molecular formula C12H25ClN4O2S and a molecular weight of 324.88 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-2-ethyl-N-methylpyrazole-3-sulfonamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-2-ethyl-N-methylpyrazole-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120712297 |
| Molecular Formula | C12H25ClN4O2S |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-2-ethyl-N-methylpyrazole-3-sulfonamide;hydrochloride |
| SMILES | CCn1nccc1S(=O)(=O)N(C)CCC(N)C(C)C.Cl |
| InChI | InChI=1S/C12H24N4O2S.ClH/c1-5-16-12(6-8-14-16)19(17,18)15(4)9-7-11(13)10(2)3;/h6,8,10-11H,5,7,9,13H2,1-4H3;1H |
| InChIKey | GVEUYHRVFBOQKI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |